C22H31IN6 — CID 111720842
2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide (PubChem CID 111720842) has the molecular formula C22H31IN6 and a molecular weight of 506.44 g/mol. Its IUPAC name is 2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide.
| Compound Name | 2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111720842 |
| Molecular Formula | C22H31IN6 |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
| SMILES | CN1CCN(c2ccc(C/N=C(\N)Nc3cccc4c3CCCC4)cn2)CC1.I |
| InChI | InChI=1S/C22H30N6.HI/c1-27-11-13-28(14-12-27)21-10-9-17(15-24-21)16-25-22(23)26-20-8-4-6-18-5-2-3-7-19(18)20;/h4,6,8-10,15H,2-3,5,7,11-14,16H2,1H3,(H3,23,25,26);1H |
| InChIKey | FVAHBXLDBNPDBI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|