C22H29N5 — CID 111720865
2-[(2-piperidin-1-yl-4-pyridinyl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine (PubChem CID 111720865) has the molecular formula C22H29N5 and a molecular weight of 363.51 g/mol. Its IUPAC name is 2-[(2-piperidin-1-yl-4-pyridinyl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine.
| Compound Name | 2-[(2-piperidin-1-yl-4-pyridinyl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
|---|---|
| PubChem CID | 111720865 |
| Molecular Formula | C22H29N5 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 2-[(2-piperidin-1-yl-4-pyridinyl)methyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine |
| SMILES | N/C(=N\Cc1ccnc(N2CCCCC2)c1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C22H29N5/c23-22(26-20-10-6-8-18-7-2-3-9-19(18)20)25-16-17-11-12-24-21(15-17)27-13-4-1-5-14-27/h6,8,10-12,15H,1-5,7,9,13-14,16H2,(H3,23,25,26) |
| InChIKey | KGZCDQFXUBFGNJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|