C16H27N5 — CID 111041199
1-tert-butyl-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 111041199) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is 1-tert-butyl-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 1-tert-butyl-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111041199 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 1-tert-butyl-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | CC(C)(C)N/C(N)=N/Cc1ccnc(N2CCCCC2)c1 |
| InChI | InChI=1S/C16H27N5/c1-16(2,3)20-15(17)19-12-13-7-8-18-14(11-13)21-9-5-4-6-10-21/h7-8,11H,4-6,9-10,12H2,1-3H3,(H3,17,19,20) |
| InChIKey | CAXBBOMTGFVPSS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|