C20H26Cl2IN5 — CID 111041260
1-[1-(2,4-dichlorophenyl)ethyl]-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111041260) has the molecular formula C20H26Cl2IN5 and a molecular weight of 534.27 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111041260 |
| Molecular Formula | C20H26Cl2IN5 |
| Molecular Weight | 534.27 g/mol |
| Exact Mass | 533.06 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/Cc1ccnc(N2CCCCC2)c1)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C20H25Cl2N5.HI/c1-14(17-6-5-16(21)12-18(17)22)26-20(23)25-13-15-7-8-24-19(11-15)27-9-3-2-4-10-27;/h5-8,11-12,14H,2-4,9-10,13H2,1H3,(H3,23,25,26);1H |
| InChIKey | PIWOVRSXHRNVTQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.27 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|