C15H26N6 — CID 111049026
2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-1-propan-2-ylguanidine (PubChem CID 111049026) has the molecular formula C15H26N6 and a molecular weight of 290.42 g/mol. Its IUPAC name is 2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-1-propan-2-ylguanidine.
| Compound Name | 2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-1-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111049026 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-1-propan-2-ylguanidine |
| SMILES | CC(C)N/C(N)=N/Cc1ccnc(N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C15H26N6/c1-12(2)19-15(16)18-11-13-4-5-17-14(10-13)21-8-6-20(3)7-9-21/h4-5,10,12H,6-9,11H2,1-3H3,(H3,16,18,19) |
| InChIKey | MEKABKUEZSMZIJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|