C19H33N7 — CID 111049072
1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine (PubChem CID 111049072) has the molecular formula C19H33N7 and a molecular weight of 359.52 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111049072 |
| Molecular Formula | C19H33N7 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
| SMILES | CCN1CCCC1CN/C(N)=N/Cc1ccnc(N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C19H33N7/c1-3-25-8-4-5-17(25)15-23-19(20)22-14-16-6-7-21-18(13-16)26-11-9-24(2)10-12-26/h6-7,13,17H,3-5,8-12,14-15H2,1-2H3,(H3,20,22,23) |
| InChIKey | JICVJTZIDIZTDQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|