C15H23FN4O — CID 111817052
1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluoro-4-hydroxyphenyl)methyl]guanidine (PubChem CID 111817052) has the molecular formula C15H23FN4O and a molecular weight of 294.37 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluoro-4-hydroxyphenyl)methyl]guanidine.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluoro-4-hydroxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111817052 |
| Molecular Formula | C15H23FN4O |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluoro-4-hydroxyphenyl)methyl]guanidine |
| SMILES | CCN1CCCC1CN/C(N)=N/Cc1ccc(O)c(F)c1 |
| InChI | InChI=1S/C15H23FN4O/c1-2-20-7-3-4-12(20)10-19-15(17)18-9-11-5-6-14(21)13(16)8-11/h5-6,8,12,21H,2-4,7,9-10H2,1H3,(H3,17,18,19) |
| InChIKey | YZNJZESWJJBRAA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|