C19H30FN5O — CID 111068341
1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]guanidine (PubChem CID 111068341) has the molecular formula C19H30FN5O and a molecular weight of 363.48 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]guanidine.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111068341 |
| Molecular Formula | C19H30FN5O |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]guanidine |
| SMILES | CCN1CCCC1CN/C(N)=N/Cc1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C19H30FN5O/c1-2-24-7-3-4-16(24)14-23-19(21)22-13-15-5-6-18(17(20)12-15)25-8-10-26-11-9-25/h5-6,12,16H,2-4,7-11,13-14H2,1H3,(H3,21,22,23) |
| InChIKey | ZTJCCKFMHULUOU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|