C15H24FIN4 — CID 111044153
1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluorophenyl)methyl]guanidine;hydroiodide (PubChem CID 111044153) has the molecular formula C15H24FIN4 and a molecular weight of 406.29 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluorophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluorophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111044153 |
| Molecular Formula | C15H24FIN4 |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluorophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN1CCCC1CN/C(N)=N/Cc1cccc(F)c1.I |
| InChI | InChI=1S/C15H23FN4.HI/c1-2-20-8-4-7-14(20)11-19-15(17)18-10-12-5-3-6-13(16)9-12;/h3,5-6,9,14H,2,4,7-8,10-11H2,1H3,(H3,17,18,19);1H |
| InChIKey | IXOLUZUXOABWDY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|