C15H23BrFIN4 — CID 111076974
2-[(3-bromo-5-fluorophenyl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111076974) has the molecular formula C15H23BrFIN4 and a molecular weight of 485.18 g/mol. Its IUPAC name is 2-[(3-bromo-5-fluorophenyl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(3-bromo-5-fluorophenyl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111076974 |
| Molecular Formula | C15H23BrFIN4 |
| Molecular Weight | 485.18 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | 2-[(3-bromo-5-fluorophenyl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN1CCCC1CN/C(N)=N/Cc1cc(F)cc(Br)c1.I |
| InChI | InChI=1S/C15H22BrFN4.HI/c1-2-21-5-3-4-14(21)10-20-15(18)19-9-11-6-12(16)8-13(17)7-11;/h6-8,14H,2-5,9-10H2,1H3,(H3,18,19,20);1H |
| InChIKey | XDMYJDZSXLWNLC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.18 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|