C13H22BrIN4S — CID 111066995
2-[(5-bromothiophen-2-yl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111066995) has the molecular formula C13H22BrIN4S and a molecular weight of 473.22 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111066995 |
| Molecular Formula | C13H22BrIN4S |
| Molecular Weight | 473.22 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN1CCCC1CN/C(N)=N/Cc1ccc(Br)s1.I |
| InChI | InChI=1S/C13H21BrN4S.HI/c1-2-18-7-3-4-10(18)8-16-13(15)17-9-11-5-6-12(14)19-11;/h5-6,10H,2-4,7-9H2,1H3,(H3,15,16,17);1H |
| InChIKey | RYYLWSDVSVLEND-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|