C22H36N6O — CID 111803805
1-[[3-[[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide (PubChem CID 111803805) has the molecular formula C22H36N6O and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-[[3-[[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-[[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111803805 |
| Molecular Formula | C22H36N6O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 1-[[3-[[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide |
| SMILES | CCN1CCCC1CN/C(N)=N/Cc1cccc(CN2CCCC(C(N)=O)C2)c1 |
| InChI | InChI=1S/C22H36N6O/c1-2-28-11-5-9-20(28)14-26-22(24)25-13-17-6-3-7-18(12-17)15-27-10-4-8-19(16-27)21(23)29/h3,6-7,12,19-20H,2,4-5,8-11,13-16H2,1H3,(H2,23,29)(H3,24,25,26) |
| InChIKey | HWGNCTDPUKNVHX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|