C20H32IN5O — CID 111759482
1-[[3-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111759482) has the molecular formula C20H32IN5O and a molecular weight of 485.41 g/mol. Its IUPAC name is 1-[[3-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[[3-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111759482 |
| Molecular Formula | C20H32IN5O |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 1-[[3-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(CN2CCCC(C(N)=O)C2)c1)NC1CC1.I |
| InChI | InChI=1S/C20H31N5O.HI/c1-2-22-20(24-18-8-9-18)23-12-15-5-3-6-16(11-15)13-25-10-4-7-17(14-25)19(21)26;/h3,5-6,11,17-18H,2,4,7-10,12-14H2,1H3,(H2,21,26)(H2,22,23,24);1H |
| InChIKey | BIJJLGAHOQEWDG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|