C23H34N6O2 — CID 109430415
1-[[3-[[[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide (PubChem CID 109430415) has the molecular formula C23H34N6O2 and a molecular weight of 426.57 g/mol. Its IUPAC name is 1-[[3-[[[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-[[[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 109430415 |
| Molecular Formula | C23H34N6O2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 1-[[3-[[[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide |
| SMILES | CCN/C(=N\Cc1cccc(CN2CCCC(C(N)=O)C2)c1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C23H34N6O2/c1-4-25-23(27-13-21-28-16(2)17(3)31-21)26-12-18-7-5-8-19(11-18)14-29-10-6-9-20(15-29)22(24)30/h5,7-8,11,20H,4,6,9-10,12-15H2,1-3H3,(H2,24,30)(H2,25,26,27) |
| InChIKey | YZKOSJNBLALINW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 108.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|