C25H36IN5O — CID 111803780
1-[[3-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111803780) has the molecular formula C25H36IN5O and a molecular weight of 549.50 g/mol. Its IUPAC name is 1-[[3-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[[3-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111803780 |
| Molecular Formula | C25H36IN5O |
| Molecular Weight | 549.50 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | 1-[[3-[[[amino-(2,6-diethylanilino)methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | CCc1cccc(CC)c1N/C(N)=N/Cc1cccc(CN2CCCC(C(N)=O)C2)c1.I |
| InChI | InChI=1S/C25H35N5O.HI/c1-3-20-10-6-11-21(4-2)23(20)29-25(27)28-15-18-8-5-9-19(14-18)16-30-13-7-12-22(17-30)24(26)31;/h5-6,8-11,14,22H,3-4,7,12-13,15-17H2,1-2H3,(H2,26,31)(H3,27,28,29);1H |
| InChIKey | OVALRJMRJQYYDD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|