C22H26F3N5O2 — CID 111803813
1-[[3-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide (PubChem CID 111803813) has the molecular formula C22H26F3N5O2 and a molecular weight of 449.48 g/mol. Its IUPAC name is 1-[[3-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-[[3-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111803813 |
| Molecular Formula | C22H26F3N5O2 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 1-[[3-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(Cc2cccc(C/N=C(\N)Nc3ccc(OC(F)(F)F)cc3)c2)C1 |
| InChI | InChI=1S/C22H26F3N5O2/c23-22(24,25)32-19-8-6-18(7-9-19)29-21(27)28-12-15-3-1-4-16(11-15)13-30-10-2-5-17(14-30)20(26)31/h1,3-4,6-9,11,17H,2,5,10,12-14H2,(H2,26,31)(H3,27,28,29) |
| InChIKey | VOWJGVPPSPQLQO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|