C16H16F3IN4O2 — CID 111058728
3-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111058728) has the molecular formula C16H16F3IN4O2 and a molecular weight of 480.23 g/mol. Its IUPAC name is 3-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | 3-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111058728 |
| Molecular Formula | C16H16F3IN4O2 |
| Molecular Weight | 480.23 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 3-[[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | I.NC(=O)c1cccc(C/N=C(\N)Nc2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C16H15F3N4O2.HI/c17-16(18,19)25-13-6-4-12(5-7-13)23-15(21)22-9-10-2-1-3-11(8-10)14(20)24;/h1-8H,9H2,(H2,20,24)(H3,21,22,23);1H |
| InChIKey | MWYXITXTMJRQBP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|