C15H14F4IN3O2 — CID 111817069
2-[(3-fluoro-4-hydroxyphenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 111817069) has the molecular formula C15H14F4IN3O2 and a molecular weight of 471.19 g/mol. Its IUPAC name is 2-[(3-fluoro-4-hydroxyphenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-[(3-fluoro-4-hydroxyphenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111817069 |
| Molecular Formula | C15H14F4IN3O2 |
| Molecular Weight | 471.19 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | 2-[(3-fluoro-4-hydroxyphenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(O)c(F)c1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F4N3O2.HI/c16-12-7-9(1-6-13(12)23)8-21-14(20)22-10-2-4-11(5-3-10)24-15(17,18)19;/h1-7,23H,8H2,(H3,20,21,22);1H |
| InChIKey | RTPZEQXSKGHLPN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|