C15H12BrF4N3O — CID 111086703
2-[(4-bromo-3-fluorophenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 111086703) has the molecular formula C15H12BrF4N3O and a molecular weight of 406.18 g/mol. Its IUPAC name is 2-[(4-bromo-3-fluorophenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[(4-bromo-3-fluorophenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 111086703 |
| Molecular Formula | C15H12BrF4N3O |
| Molecular Weight | 406.18 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 2-[(4-bromo-3-fluorophenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(Br)c(F)c1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12BrF4N3O/c16-12-6-1-9(7-13(12)17)8-22-14(21)23-10-2-4-11(5-3-10)24-15(18,19)20/h1-7H,8H2,(H3,21,22,23) |
| InChIKey | VAHZNOZMJQVZNA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.18 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|