C17H17BrF3N3O — CID 57268995
1-(2-bromo-5-ethylphenyl)-2-[[3-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 57268995) has the molecular formula C17H17BrF3N3O and a molecular weight of 416.24 g/mol. Its IUPAC name is 1-(2-bromo-5-ethylphenyl)-2-[[3-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-(2-bromo-5-ethylphenyl)-2-[[3-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 57268995 |
| Molecular Formula | C17H17BrF3N3O |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 1-(2-bromo-5-ethylphenyl)-2-[[3-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | CCc1ccc(Br)c(N/C(N)=N/Cc2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H17BrF3N3O/c1-2-11-6-7-14(18)15(9-11)24-16(22)23-10-12-4-3-5-13(8-12)25-17(19,20)21/h3-9H,2,10H2,1H3,(H3,22,23,24) |
| InChIKey | ZTKGKZPZIOCXIH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|