C18H21F2N3O — CID 111097979
2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-(4-ethylphenyl)guanidine (PubChem CID 111097979) has the molecular formula C18H21F2N3O and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-(4-ethylphenyl)guanidine.
| Compound Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-(4-ethylphenyl)guanidine |
|---|---|
| PubChem CID | 111097979 |
| Molecular Formula | C18H21F2N3O |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-(4-ethylphenyl)guanidine |
| SMILES | CCc1ccc(N/C(N)=N/Cc2cccc(OCC(F)F)c2)cc1 |
| InChI | InChI=1S/C18H21F2N3O/c1-2-13-6-8-15(9-7-13)23-18(21)22-11-14-4-3-5-16(10-14)24-12-17(19)20/h3-10,17H,2,11-12H2,1H3,(H3,21,22,23) |
| InChIKey | CFXGSQDICLVSHB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|