C18H22N4O2 — CID 111801752
2-[3-[[[amino-(3-ethylanilino)methylidene]amino]methyl]phenoxy]acetamide (PubChem CID 111801752) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[3-[[[amino-(3-ethylanilino)methylidene]amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[[amino-(3-ethylanilino)methylidene]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111801752 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-[3-[[[amino-(3-ethylanilino)methylidene]amino]methyl]phenoxy]acetamide |
| SMILES | CCc1cccc(N/C(N)=N/Cc2cccc(OCC(N)=O)c2)c1 |
| InChI | InChI=1S/C18H22N4O2/c1-2-13-5-3-7-15(9-13)22-18(20)21-11-14-6-4-8-16(10-14)24-12-17(19)23/h3-10H,2,11-12H2,1H3,(H2,19,23)(H3,20,21,22) |
| InChIKey | IIGINEGNEPMHHJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|