C14H22N4O2 — CID 111801822
2-[3-[[[amino(butylamino)methylidene]amino]methyl]phenoxy]acetamide (PubChem CID 111801822) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-[3-[[[amino(butylamino)methylidene]amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[[amino(butylamino)methylidene]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111801822 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-[3-[[[amino(butylamino)methylidene]amino]methyl]phenoxy]acetamide |
| SMILES | CCCCN/C(N)=N/Cc1cccc(OCC(N)=O)c1 |
| InChI | InChI=1S/C14H22N4O2/c1-2-3-7-17-14(16)18-9-11-5-4-6-12(8-11)20-10-13(15)19/h4-6,8H,2-3,7,9-10H2,1H3,(H2,15,19)(H3,16,17,18) |
| InChIKey | JHYLXAREYUGSSB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|