C13H22IN3O — CID 110912184
2-[(3-ethoxyphenyl)methyl]-1-propylguanidine;hydroiodide (PubChem CID 110912184) has the molecular formula C13H22IN3O and a molecular weight of 363.24 g/mol. Its IUPAC name is 2-[(3-ethoxyphenyl)methyl]-1-propylguanidine;hydroiodide.
| Compound Name | 2-[(3-ethoxyphenyl)methyl]-1-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110912184 |
| Molecular Formula | C13H22IN3O |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-[(3-ethoxyphenyl)methyl]-1-propylguanidine;hydroiodide |
| SMILES | CCCN/C(N)=N/Cc1cccc(OCC)c1.I |
| InChI | InChI=1S/C13H21N3O.HI/c1-3-8-15-13(14)16-10-11-6-5-7-12(9-11)17-4-2;/h5-7,9H,3-4,8,10H2,1-2H3,(H3,14,15,16);1H |
| InChIKey | ACUWFKPDWFGFNR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|