C18H22N4O2 — CID 111801800
2-[3-[[[amino-(3,5-dimethylanilino)methylidene]amino]methyl]phenoxy]acetamide (PubChem CID 111801800) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[3-[[[amino-(3,5-dimethylanilino)methylidene]amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[[amino-(3,5-dimethylanilino)methylidene]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111801800 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-[3-[[[amino-(3,5-dimethylanilino)methylidene]amino]methyl]phenoxy]acetamide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/Cc2cccc(OCC(N)=O)c2)c1 |
| InChI | InChI=1S/C18H22N4O2/c1-12-6-13(2)8-15(7-12)22-18(20)21-10-14-4-3-5-16(9-14)24-11-17(19)23/h3-9H,10-11H2,1-2H3,(H2,19,23)(H3,20,21,22) |
| InChIKey | OVZFJFHSEFMEGP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|