C14H23IN4O3 — CID 111801765
2-[3-[[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111801765) has the molecular formula C14H23IN4O3 and a molecular weight of 422.27 g/mol. Its IUPAC name is 2-[3-[[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[3-[[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111801765 |
| Molecular Formula | C14H23IN4O3 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 2-[3-[[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | COCC(C)N/C(N)=N/Cc1cccc(OCC(N)=O)c1.I |
| InChI | InChI=1S/C14H22N4O3.HI/c1-10(8-20-2)18-14(16)17-7-11-4-3-5-12(6-11)21-9-13(15)19;/h3-6,10H,7-9H2,1-2H3,(H2,15,19)(H3,16,17,18);1H |
| InChIKey | DOSLPYLTTJUBEN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|