C17H28N4O2S — CID 111987377
2-[3-[[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]methyl]phenoxy]acetamide (PubChem CID 111987377) has the molecular formula C17H28N4O2S and a molecular weight of 352.50 g/mol. Its IUPAC name is 2-[3-[[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111987377 |
| Molecular Formula | C17H28N4O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-[3-[[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]methyl]phenoxy]acetamide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(N)=O)c1)NCCCCSC |
| InChI | InChI=1S/C17H28N4O2S/c1-3-19-17(20-9-4-5-10-24-2)21-12-14-7-6-8-15(11-14)23-13-16(18)22/h6-8,11H,3-5,9-10,12-13H2,1-2H3,(H2,18,22)(H2,19,20,21) |
| InChIKey | LAXXIAMOQPDZRQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|