C18H29N5O3 — CID 111767677
2-[[N'-[[3-(2-amino-2-oxoethoxy)phenyl]methyl]-N-ethylcarbamimidoyl]amino]-N-tert-butylacetamide (PubChem CID 111767677) has the molecular formula C18H29N5O3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[[N'-[[3-(2-amino-2-oxoethoxy)phenyl]methyl]-N-ethylcarbamimidoyl]amino]-N-tert-butylacetamide.
| Compound Name | 2-[[N'-[[3-(2-amino-2-oxoethoxy)phenyl]methyl]-N-ethylcarbamimidoyl]amino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 111767677 |
| Molecular Formula | C18H29N5O3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 2-[[N'-[[3-(2-amino-2-oxoethoxy)phenyl]methyl]-N-ethylcarbamimidoyl]amino]-N-tert-butylacetamide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(N)=O)c1)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H29N5O3/c1-5-20-17(22-11-16(25)23-18(2,3)4)21-10-13-7-6-8-14(9-13)26-12-15(19)24/h6-9H,5,10-12H2,1-4H3,(H2,19,24)(H,23,25)(H2,20,21,22) |
| InChIKey | CAUFUBMJCBZDLF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|