C19H32IN5O3 — CID 111547732
2-[3-[[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111547732) has the molecular formula C19H32IN5O3 and a molecular weight of 505.40 g/mol. Its IUPAC name is 2-[3-[[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[3-[[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111547732 |
| Molecular Formula | C19H32IN5O3 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 2-[3-[[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(N)=O)c1)NCCCN1CCOCC1.I |
| InChI | InChI=1S/C19H31N5O3.HI/c1-2-21-19(22-7-4-8-24-9-11-26-12-10-24)23-14-16-5-3-6-17(13-16)27-15-18(20)25;/h3,5-6,13H,2,4,7-12,14-15H2,1H3,(H2,20,25)(H2,21,22,23);1H |
| InChIKey | JLCIUEDOXATTIS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|