C16H20N4O2S — CID 111059401
1-(3-ethylphenyl)-2-[(3-sulfamoylphenyl)methyl]guanidine (PubChem CID 111059401) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-2-[(3-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-(3-ethylphenyl)-2-[(3-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111059401 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-(3-ethylphenyl)-2-[(3-sulfamoylphenyl)methyl]guanidine |
| SMILES | CCc1cccc(N/C(N)=N/Cc2cccc(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C16H20N4O2S/c1-2-12-5-3-7-14(9-12)20-16(17)19-11-13-6-4-8-15(10-13)23(18,21)22/h3-10H,2,11H2,1H3,(H3,17,19,20)(H2,18,21,22) |
| InChIKey | ROYIDIBWVCLRQT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|