C12H21IN4O2S — CID 111059378
1-(2-methylpropyl)-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111059378) has the molecular formula C12H21IN4O2S and a molecular weight of 412.30 g/mol. Its IUPAC name is 1-(2-methylpropyl)-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methylpropyl)-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111059378 |
| Molecular Formula | C12H21IN4O2S |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 1-(2-methylpropyl)-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CC(C)CN/C(N)=N/Cc1cccc(S(N)(=O)=O)c1.I |
| InChI | InChI=1S/C12H20N4O2S.HI/c1-9(2)7-15-12(13)16-8-10-4-3-5-11(6-10)19(14,17)18;/h3-6,9H,7-8H2,1-2H3,(H3,13,15,16)(H2,14,17,18);1H |
| InChIKey | WVCBIOPFJJHRDZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|