C13H19F2N3O — CID 111093283
2-[[3-(difluoromethoxy)phenyl]methyl]-1-(2-methylpropyl)guanidine (PubChem CID 111093283) has the molecular formula C13H19F2N3O and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-[[3-(difluoromethoxy)phenyl]methyl]-1-(2-methylpropyl)guanidine.
| Compound Name | 2-[[3-(difluoromethoxy)phenyl]methyl]-1-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 111093283 |
| Molecular Formula | C13H19F2N3O |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-[[3-(difluoromethoxy)phenyl]methyl]-1-(2-methylpropyl)guanidine |
| SMILES | CC(C)CN/C(N)=N/Cc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C13H19F2N3O/c1-9(2)7-17-13(16)18-8-10-4-3-5-11(6-10)19-12(14)15/h3-6,9,12H,7-8H2,1-2H3,(H3,16,17,18) |
| InChIKey | DSTCPYSEGNAJSD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|