C11H18N4 — CID 62361961
1-(2-methylpropyl)-2-(pyridin-3-ylmethyl)guanidine (PubChem CID 62361961) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(2-methylpropyl)-2-(pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-(2-methylpropyl)-2-(pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 62361961 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-(2-methylpropyl)-2-(pyridin-3-ylmethyl)guanidine |
| SMILES | CC(C)CN/C(N)=N/Cc1cccnc1 |
| InChI | InChI=1S/C11H18N4/c1-9(2)6-14-11(12)15-8-10-4-3-5-13-7-10/h3-5,7,9H,6,8H2,1-2H3,(H3,12,14,15) |
| InChIKey | PWSSUAFPUXQAAY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|