C17H22FIN4O — CID 111083134
2-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-1-(2-methylpropyl)guanidine;hydroiodide (PubChem CID 111083134) has the molecular formula C17H22FIN4O and a molecular weight of 444.29 g/mol. Its IUPAC name is 2-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-1-(2-methylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-1-(2-methylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111083134 |
| Molecular Formula | C17H22FIN4O |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 2-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-1-(2-methylpropyl)guanidine;hydroiodide |
| SMILES | CC(C)CN/C(N)=N/Cc1ccc(Oc2cccnc2)c(F)c1.I |
| InChI | InChI=1S/C17H21FN4O.HI/c1-12(2)9-21-17(19)22-10-13-5-6-16(15(18)8-13)23-14-4-3-7-20-11-14;/h3-8,11-12H,9-10H2,1-2H3,(H3,19,21,22);1H |
| InChIKey | OHMVMVCNRHDZIM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|