C17H19FN4OS — CID 111083185
N'-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 111083185) has the molecular formula C17H19FN4OS and a molecular weight of 346.43 g/mol. Its IUPAC name is N'-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111083185 |
| Molecular Formula | C17H19FN4OS |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N'-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\Cc1ccc(Oc2cccnc2)c(F)c1)N1CCSCC1 |
| InChI | InChI=1S/C17H19FN4OS/c18-15-10-13(11-21-17(19)22-6-8-24-9-7-22)3-4-16(15)23-14-2-1-5-20-12-14/h1-5,10,12H,6-9,11H2,(H2,19,21) |
| InChIKey | WZXWBEYLOOKSTN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|