C13H18BrN3OS — CID 111095676
N'-[(3-bromo-4-methoxyphenyl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 111095676) has the molecular formula C13H18BrN3OS and a molecular weight of 344.28 g/mol. Its IUPAC name is N'-[(3-bromo-4-methoxyphenyl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[(3-bromo-4-methoxyphenyl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111095676 |
| Molecular Formula | C13H18BrN3OS |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | N'-[(3-bromo-4-methoxyphenyl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | COc1ccc(C/N=C(\N)N2CCSCC2)cc1Br |
| InChI | InChI=1S/C13H18BrN3OS/c1-18-12-3-2-10(8-11(12)14)9-16-13(15)17-4-6-19-7-5-17/h2-3,8H,4-7,9H2,1H3,(H2,15,16) |
| InChIKey | IAMGEBTVMZARDJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|