C14H21N3OS — CID 111067942
N'-[(4-hydroxy-3,5-dimethylphenyl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 111067942) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is N'-[(4-hydroxy-3,5-dimethylphenyl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[(4-hydroxy-3,5-dimethylphenyl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111067942 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N'-[(4-hydroxy-3,5-dimethylphenyl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | Cc1cc(C/N=C(\N)N2CCSCC2)cc(C)c1O |
| InChI | InChI=1S/C14H21N3OS/c1-10-7-12(8-11(2)13(10)18)9-16-14(15)17-3-5-19-6-4-17/h7-8,18H,3-6,9H2,1-2H3,(H2,15,16) |
| InChIKey | MWGPGIXBVDIFAW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|