C13H21IN4O2S2 — CID 120581686
N'-[(2-methyl-4-sulfamoylphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 120581686) has the molecular formula C13H21IN4O2S2 and a molecular weight of 456.38 g/mol. Its IUPAC name is N'-[(2-methyl-4-sulfamoylphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(2-methyl-4-sulfamoylphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120581686 |
| Molecular Formula | C13H21IN4O2S2 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | N'-[(2-methyl-4-sulfamoylphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | Cc1cc(S(N)(=O)=O)ccc1C/N=C(\N)N1CCSCC1.I |
| InChI | InChI=1S/C13H20N4O2S2.HI/c1-10-8-12(21(15,18)19)3-2-11(10)9-16-13(14)17-4-6-20-7-5-17;/h2-3,8H,4-7,9H2,1H3,(H2,14,16)(H2,15,18,19);1H |
| InChIKey | HIJVRAHXOJLOPD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|