C12H15F2N3S — CID 111801004
N'-[(2,5-difluorophenyl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 111801004) has the molecular formula C12H15F2N3S and a molecular weight of 271.34 g/mol. Its IUPAC name is N'-[(2,5-difluorophenyl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[(2,5-difluorophenyl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111801004 |
| Molecular Formula | C12H15F2N3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N'-[(2,5-difluorophenyl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\Cc1cc(F)ccc1F)N1CCSCC1 |
| InChI | InChI=1S/C12H15F2N3S/c13-10-1-2-11(14)9(7-10)8-16-12(15)17-3-5-18-6-4-17/h1-2,7H,3-6,8H2,(H2,15,16) |
| InChIKey | QAKYELHYBLLOSP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|