C14H18FN3 — CID 122097017
N'-[(5-cyclopropyl-2-fluorophenyl)methyl]azetidine-1-carboximidamide (PubChem CID 122097017) has the molecular formula C14H18FN3 and a molecular weight of 247.32 g/mol. Its IUPAC name is N'-[(5-cyclopropyl-2-fluorophenyl)methyl]azetidine-1-carboximidamide.
| Compound Name | N'-[(5-cyclopropyl-2-fluorophenyl)methyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 122097017 |
| Molecular Formula | C14H18FN3 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | N'-[(5-cyclopropyl-2-fluorophenyl)methyl]azetidine-1-carboximidamide |
| SMILES | N/C(=N\Cc1cc(C2CC2)ccc1F)N1CCC1 |
| InChI | InChI=1S/C14H18FN3/c15-13-5-4-11(10-2-3-10)8-12(13)9-17-14(16)18-6-1-7-18/h4-5,8,10H,1-3,6-7,9H2,(H2,16,17) |
| InChIKey | LMHMEYJDTFFFHU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|