C14H19ClFN3 — CID 111045706
N'-[(3-chloro-4-fluorophenyl)methyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 111045706) has the molecular formula C14H19ClFN3 and a molecular weight of 283.78 g/mol. Its IUPAC name is N'-[(3-chloro-4-fluorophenyl)methyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[(3-chloro-4-fluorophenyl)methyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111045706 |
| Molecular Formula | C14H19ClFN3 |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N'-[(3-chloro-4-fluorophenyl)methyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/Cc2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H19ClFN3/c1-10-3-2-6-19(9-10)14(17)18-8-11-4-5-13(16)12(15)7-11/h4-5,7,10H,2-3,6,8-9H2,1H3,(H2,17,18) |
| InChIKey | ATOUHDIYVSXZKP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|