C14H20BrFIN3 — CID 111045773
N'-[(2-bromo-5-fluorophenyl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111045773) has the molecular formula C14H20BrFIN3 and a molecular weight of 456.14 g/mol. Its IUPAC name is N'-[(2-bromo-5-fluorophenyl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(2-bromo-5-fluorophenyl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111045773 |
| Molecular Formula | C14H20BrFIN3 |
| Molecular Weight | 456.14 g/mol |
| Exact Mass | 454.99 |
| IUPAC Name | N'-[(2-bromo-5-fluorophenyl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCCN(/C(N)=N/Cc2cc(F)ccc2Br)C1.I |
| InChI | InChI=1S/C14H19BrFN3.HI/c1-10-3-2-6-19(9-10)14(17)18-8-11-7-12(16)4-5-13(11)15;/h4-5,7,10H,2-3,6,8-9H2,1H3,(H2,17,18);1H |
| InChIKey | VNKAJEPAYHOACO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.14 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|