C12H15BrFN3 — CID 110029810
2-[(2-bromo-5-fluorophenyl)methyl]-1-cyclopropyl-1-methylguanidine (PubChem CID 110029810) has the molecular formula C12H15BrFN3 and a molecular weight of 300.17 g/mol. Its IUPAC name is 2-[(2-bromo-5-fluorophenyl)methyl]-1-cyclopropyl-1-methylguanidine.
| Compound Name | 2-[(2-bromo-5-fluorophenyl)methyl]-1-cyclopropyl-1-methylguanidine |
|---|---|
| PubChem CID | 110029810 |
| Molecular Formula | C12H15BrFN3 |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2-[(2-bromo-5-fluorophenyl)methyl]-1-cyclopropyl-1-methylguanidine |
| SMILES | CN(/C(N)=N/Cc1cc(F)ccc1Br)C1CC1 |
| InChI | InChI=1S/C12H15BrFN3/c1-17(10-3-4-10)12(15)16-7-8-6-9(14)2-5-11(8)13/h2,5-6,10H,3-4,7H2,1H3,(H2,15,16) |
| InChIKey | INWRXRFOGREVHT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|