C14H21BrIN3O2 — CID 110030833
2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide (PubChem CID 110030833) has the molecular formula C14H21BrIN3O2 and a molecular weight of 470.15 g/mol. Its IUPAC name is 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide.
| Compound Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110030833 |
| Molecular Formula | C14H21BrIN3O2 |
| Molecular Weight | 470.15 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-cyclopropyl-1-methylguanidine;hydroiodide |
| SMILES | COc1cc(C/N=C(\N)N(C)C2CC2)cc(Br)c1OC.I |
| InChI | InChI=1S/C14H20BrN3O2.HI/c1-18(10-4-5-10)14(16)17-8-9-6-11(15)13(20-3)12(7-9)19-2;/h6-7,10H,4-5,8H2,1-3H3,(H2,16,17);1H |
| InChIKey | UCEFDYCCGOEGCO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.15 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|