C17H21BrIN3O2 — CID 111094609
2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-(4-methylphenyl)guanidine;hydroiodide (PubChem CID 111094609) has the molecular formula C17H21BrIN3O2 and a molecular weight of 506.18 g/mol. Its IUPAC name is 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-(4-methylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-(4-methylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111094609 |
| Molecular Formula | C17H21BrIN3O2 |
| Molecular Weight | 506.18 g/mol |
| Exact Mass | 504.99 |
| IUPAC Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1-(4-methylphenyl)guanidine;hydroiodide |
| SMILES | COc1cc(C/N=C(\N)Nc2ccc(C)cc2)cc(Br)c1OC.I |
| InChI | InChI=1S/C17H20BrN3O2.HI/c1-11-4-6-13(7-5-11)21-17(19)20-10-12-8-14(18)16(23-3)15(9-12)22-2;/h4-9H,10H2,1-3H3,(H3,19,20,21);1H |
| InChIKey | GPKPCNJPXTYZFV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.18 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|