C19H24IN3O2 — CID 110930329
2-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1-phenylguanidine;hydroiodide (PubChem CID 110930329) has the molecular formula C19H24IN3O2 and a molecular weight of 453.32 g/mol. Its IUPAC name is 2-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110930329 |
| Molecular Formula | C19H24IN3O2 |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 2-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1-phenylguanidine;hydroiodide |
| SMILES | C=CCc1cc(C/N=C(\N)Nc2ccccc2)cc(OC)c1OC.I |
| InChI | InChI=1S/C19H23N3O2.HI/c1-4-8-15-11-14(12-17(23-2)18(15)24-3)13-21-19(20)22-16-9-6-5-7-10-16;/h4-7,9-12H,1,8,13H2,2-3H3,(H3,20,21,22);1H |
| InChIKey | DCPVJGUEXWPPTQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|