C20H26IN3O3 — CID 111093548
2-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111093548) has the molecular formula C20H26IN3O3 and a molecular weight of 483.35 g/mol. Its IUPAC name is 2-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111093548 |
| Molecular Formula | C20H26IN3O3 |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 2-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide |
| SMILES | C=CCc1cc(C/N=C(\N)Nc2ccc(OC)cc2)cc(OC)c1OC.I |
| InChI | InChI=1S/C20H25N3O3.HI/c1-5-6-15-11-14(12-18(25-3)19(15)26-4)13-22-20(21)23-16-7-9-17(24-2)10-8-16;/h5,7-12H,1,6,13H2,2-4H3,(H3,21,22,23);1H |
| InChIKey | HABYWSKAWGRALC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|