C24H28N6O2 — CID 110062228
2-[[3-[[[amino-(4-methoxyanilino)methylidene]amino]methyl]phenyl]methyl]-1-(4-methoxyphenyl)guanidine (PubChem CID 110062228) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-[[3-[[[amino-(4-methoxyanilino)methylidene]amino]methyl]phenyl]methyl]-1-(4-methoxyphenyl)guanidine.
| Compound Name | 2-[[3-[[[amino-(4-methoxyanilino)methylidene]amino]methyl]phenyl]methyl]-1-(4-methoxyphenyl)guanidine |
|---|---|
| PubChem CID | 110062228 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2-[[3-[[[amino-(4-methoxyanilino)methylidene]amino]methyl]phenyl]methyl]-1-(4-methoxyphenyl)guanidine |
| SMILES | COc1ccc(N/C(N)=N/Cc2cccc(C/N=C(\N)Nc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C24H28N6O2/c1-31-21-10-6-19(7-11-21)29-23(25)27-15-17-4-3-5-18(14-17)16-28-24(26)30-20-8-12-22(32-2)13-9-20/h3-14H,15-16H2,1-2H3,(H3,25,27,29)(H3,26,28,30) |
| InChIKey | NCZAKSQQDYWJAE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|