C15H18N4O3S — CID 111059365
1-(4-methoxyphenyl)-2-[(3-sulfamoylphenyl)methyl]guanidine (PubChem CID 111059365) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-[(3-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-(4-methoxyphenyl)-2-[(3-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111059365 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-[(3-sulfamoylphenyl)methyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/Cc2cccc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C15H18N4O3S/c1-22-13-7-5-12(6-8-13)19-15(16)18-10-11-3-2-4-14(9-11)23(17,20)21/h2-9H,10H2,1H3,(H3,16,18,19)(H2,17,20,21) |
| InChIKey | WIWMPFQPMOUXPK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|