C22H24FIN4O3S — CID 111068622
2-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111068622) has the molecular formula C22H24FIN4O3S and a molecular weight of 570.43 g/mol. Its IUPAC name is 2-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111068622 |
| Molecular Formula | C22H24FIN4O3S |
| Molecular Weight | 570.43 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | 2-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2cccc(S(=O)(=O)NCc3cccc(F)c3)c2)cc1.I |
| InChI | InChI=1S/C22H23FN4O3S.HI/c1-30-20-10-8-19(9-11-20)27-22(24)25-14-17-5-3-7-21(13-17)31(28,29)26-15-16-4-2-6-18(23)12-16;/h2-13,26H,14-15H2,1H3,(H3,24,25,27);1H |
| InChIKey | HYCKAPOQSSFPOW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|